About propan-2-ol;trimethyl(oxiran-2-ylmethyl)azanium;chloride
propan-2-ol;trimethyl(oxiran-2-ylmethyl)azanium;chloride (PubChem CID 175186062) has the molecular formula C9H22ClNO2
and a molecular weight of 211.73 g/mol. Its IUPAC name is propan-2-ol;trimethyl(oxiran-2-ylmethyl)azanium;chloride.
Molecular Properties
| Compound Name | propan-2-ol;trimethyl(oxiran-2-ylmethyl)azanium;chloride |
| PubChem CID | 175186062 |
| Molecular Formula | C9H22ClNO2 |
| Molecular Weight | 211.73 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | propan-2-ol;trimethyl(oxiran-2-ylmethyl)azanium;chloride |
| SMILES | CC(C)O.C[N+](C)(C)CC1CO1.[Cl-] |
| InChI | InChI=1S/C6H14NO.C3H8O.ClH/c1-7(2,3)4-6-5-8-6;1-3(2)4;/h6H,4-5H2,1-3H3;3-4H,1-2H3;1H/q+1;;/p-1 |
| InChIKey | UUGPFWUWOOCSIM-UHFFFAOYSA-M |
| XLogP | -2.52 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.73 |
| LogP ≤ 5 | -2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze propan-2-ol;trimethyl(oxiran-2-ylmethyl)azanium;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-ol;trimethyl(oxiran-2-ylmethyl)azanium;chloride?
The IUPAC name of propan-2-ol;trimethyl(oxiran-2-ylmethyl)azanium;chloride (CID 175186062) is propan-2-ol;trimethyl(oxiran-2-ylmethyl)azanium;chloride.
What is the SMILES notation for propan-2-ol;trimethyl(oxiran-2-ylmethyl)azanium;chloride?
The canonical SMILES for propan-2-ol;trimethyl(oxiran-2-ylmethyl)azanium;chloride is CC(C)O.C[N+](C)(C)CC1CO1.[Cl-].
What is the InChIKey of propan-2-ol;trimethyl(oxiran-2-ylmethyl)azanium;chloride?
The InChIKey is UUGPFWUWOOCSIM-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H14NO.C3H8O.ClH/c1-7(2,3)4-6-5-8-6;1-3(2)4;/h6H,4-5H2,1-3H3;3-4H,1-2H3;1H/q+1;;/p-1.
What are the key properties of propan-2-ol;trimethyl(oxiran-2-ylmethyl)azanium;chloride?
propan-2-ol;trimethyl(oxiran-2-ylmethyl)azanium;chloride has a molecular weight of 211.73 g/mol, XLogP of -2.52, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-ol;trimethyl(oxiran-2-ylmethyl)azanium;chloride is sourced from PubChem (CID 175186062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).