C21H27NO4 — CID 67697450
2-[2-ethoxy-3-[3-(5-ethyl-2-pyridinyl)propoxy]phenyl]propanoic acid (PubChem CID 67697450) has the molecular formula C21H27NO4 and a molecular weight of 357.45 g/mol. Its IUPAC name is 2-[2-ethoxy-3-[3-(5-ethyl-2-pyridinyl)propoxy]phenyl]propanoic acid.
| Compound Name | 2-[2-ethoxy-3-[3-(5-ethyl-2-pyridinyl)propoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 67697450 |
| Molecular Formula | C21H27NO4 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | 2-[2-ethoxy-3-[3-(5-ethyl-2-pyridinyl)propoxy]phenyl]propanoic acid |
| SMILES | CCOc1c(OCCCc2ccc(CC)cn2)cccc1C(C)C(=O)O |
| InChI | InChI=1S/C21H27NO4/c1-4-16-11-12-17(22-14-16)8-7-13-26-19-10-6-9-18(15(3)21(23)24)20(19)25-5-2/h6,9-12,14-15H,4-5,7-8,13H2,1-3H3,(H,23,24) |
| InChIKey | YTYRFPLOTMLSTR-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|