C25H30N2O3 — CID 10294775
(2S)-2-[[4-[3-(5-ethyl-2-pyridinyl)propoxy]phenyl]methyl]-2-pyrrol-1-ylbutanoic acid (PubChem CID 10294775) has the molecular formula C25H30N2O3 and a molecular weight of 406.53 g/mol. Its IUPAC name is (2S)-2-[[4-[3-(5-ethyl-2-pyridinyl)propoxy]phenyl]methyl]-2-pyrrol-1-ylbutanoic acid.
| Compound Name | (2S)-2-[[4-[3-(5-ethyl-2-pyridinyl)propoxy]phenyl]methyl]-2-pyrrol-1-ylbutanoic acid |
|---|---|
| PubChem CID | 10294775 |
| Molecular Formula | C25H30N2O3 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | (2S)-2-[[4-[3-(5-ethyl-2-pyridinyl)propoxy]phenyl]methyl]-2-pyrrol-1-ylbutanoic acid |
| SMILES | CCc1ccc(CCCOc2ccc(C[C@@](CC)(C(=O)O)n3cccc3)cc2)nc1 |
| InChI | InChI=1S/C25H30N2O3/c1-3-20-9-12-22(26-19-20)8-7-17-30-23-13-10-21(11-14-23)18-25(4-2,24(28)29)27-15-5-6-16-27/h5-6,9-16,19H,3-4,7-8,17-18H2,1-2H3,(H,28,29)/t25-/m0/s1 |
| InChIKey | HCMNBWZCGLQONA-VWLOTQADSA-N |
| XLogP | 4.89 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|