C16H18N4O4 — CID 67698047
3-hydroxy-2,2-dimethyl-4-[2-(nitromethylidene)imidazolidin-1-yl]-3,4-dihydrochromene-6-carbonitrile (PubChem CID 67698047) has the molecular formula C16H18N4O4 and a molecular weight of 330.34 g/mol. Its IUPAC name is 3-hydroxy-2,2-dimethyl-4-[2-(nitromethylidene)imidazolidin-1-yl]-3,4-dihydrochromene-6-carbonitrile.
| Compound Name | 3-hydroxy-2,2-dimethyl-4-[2-(nitromethylidene)imidazolidin-1-yl]-3,4-dihydrochromene-6-carbonitrile |
|---|---|
| PubChem CID | 67698047 |
| Molecular Formula | C16H18N4O4 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 3-hydroxy-2,2-dimethyl-4-[2-(nitromethylidene)imidazolidin-1-yl]-3,4-dihydrochromene-6-carbonitrile |
| SMILES | CC1(C)Oc2ccc(C#N)cc2C(N2CCNC2=C[N+](=O)[O-])C1O |
| InChI | InChI=1S/C16H18N4O4/c1-16(2)15(21)14(19-6-5-18-13(19)9-20(22)23)11-7-10(8-17)3-4-12(11)24-16/h3-4,7,9,14-15,18,21H,5-6H2,1-2H3 |
| InChIKey | KUZVMCVLMONMCG-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 111.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|