C35H40N2O10S2 — CID 67699052
prop-2-enyl 4-[[4-(3-methoxy-2,3-dioxopropyl)azetidin-2-yl]sulfanylmethyl]benzoate;prop-2-enyl 4-[[1-(2-methoxy-2-oxoethyl)-4-oxoazetidin-2-yl]sulfanylmethyl]benzoate (PubChem CID 67699052) has the molecular formula C35H40N2O10S2 and a molecular weight of 712.84 g/mol. Its IUPAC name is prop-2-enyl 4-[[4-(3-methoxy-2,3-dioxopropyl)azetidin-2-yl]sulfanylmethyl]benzoate;prop-2-enyl 4-[[1-(2-methoxy-2-oxoethyl)-4-oxoazetidin-2-yl]sulfanylmethyl]benzoate.
| Compound Name | prop-2-enyl 4-[[4-(3-methoxy-2,3-dioxopropyl)azetidin-2-yl]sulfanylmethyl]benzoate;prop-2-enyl 4-[[1-(2-methoxy-2-oxoethyl)-4-oxoazetidin-2-yl]sulfanylmethyl]benzoate |
|---|---|
| PubChem CID | 67699052 |
| Molecular Formula | C35H40N2O10S2 |
| Molecular Weight | 712.84 g/mol |
| Exact Mass | 712.21 |
| IUPAC Name | prop-2-enyl 4-[[4-(3-methoxy-2,3-dioxopropyl)azetidin-2-yl]sulfanylmethyl]benzoate;prop-2-enyl 4-[[1-(2-methoxy-2-oxoethyl)-4-oxoazetidin-2-yl]sulfanylmethyl]benzoate |
| SMILES | C=CCOC(=O)c1ccc(CSC2CC(=O)N2CC(=O)OC)cc1.C=CCOC(=O)c1ccc(CSC2CC(CC(=O)C(=O)OC)N2)cc1 |
| InChI | InChI=1S/C18H21NO5S.C17H19NO5S/c1-3-8-24-17(21)13-6-4-12(5-7-13)11-25-16-10-14(19-16)9-15(20)18(22)23-2;1-3-8-23-17(21)13-6-4-12(5-7-13)11-24-15-9-14(19)18(15)10-16(20)22-2/h3-7,14,16,19H,1,8-11H2,2H3;3-7,15H,1,8-11H2,2H3 |
| InChIKey | IKSUEBOXOPKTEJ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 154.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.84 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|