C24H28N2O3S — CID 67703424
2-[2-[[2-butyl-5-ethylsulfanyl-4-(hydroxymethyl)imidazol-1-yl]methyl]phenyl]benzoic acid (PubChem CID 67703424) has the molecular formula C24H28N2O3S and a molecular weight of 424.57 g/mol. Its IUPAC name is 2-[2-[[2-butyl-5-ethylsulfanyl-4-(hydroxymethyl)imidazol-1-yl]methyl]phenyl]benzoic acid.
| Compound Name | 2-[2-[[2-butyl-5-ethylsulfanyl-4-(hydroxymethyl)imidazol-1-yl]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 67703424 |
| Molecular Formula | C24H28N2O3S |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | 2-[2-[[2-butyl-5-ethylsulfanyl-4-(hydroxymethyl)imidazol-1-yl]methyl]phenyl]benzoic acid |
| SMILES | CCCCc1nc(CO)c(SCC)n1Cc1ccccc1-c1ccccc1C(=O)O |
| InChI | InChI=1S/C24H28N2O3S/c1-3-5-14-22-25-21(16-27)23(30-4-2)26(22)15-17-10-6-7-11-18(17)19-12-8-9-13-20(19)24(28)29/h6-13,27H,3-5,14-16H2,1-2H3,(H,28,29) |
| InChIKey | LQAGLOZKWVFIKE-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |