C24H31ClN2O4S — CID 67705328
N-[(4S)-4-hydroxy-1'-(1,2,3,4-tetrahydronaphthalen-2-yl)spiro[3,4-dihydrochromene-2,4'-piperidine]-6-yl]methanesulfonamide;hydrochloride (PubChem CID 67705328) has the molecular formula C24H31ClN2O4S and a molecular weight of 479.04 g/mol. Its IUPAC name is N-[(4S)-4-hydroxy-1'-(1,2,3,4-tetrahydronaphthalen-2-yl)spiro[3,4-dihydrochromene-2,4'-piperidine]-6-yl]methanesulfonamide;hydrochloride.
| Compound Name | N-[(4S)-4-hydroxy-1'-(1,2,3,4-tetrahydronaphthalen-2-yl)spiro[3,4-dihydrochromene-2,4'-piperidine]-6-yl]methanesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 67705328 |
| Molecular Formula | C24H31ClN2O4S |
| Molecular Weight | 479.04 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | N-[(4S)-4-hydroxy-1'-(1,2,3,4-tetrahydronaphthalen-2-yl)spiro[3,4-dihydrochromene-2,4'-piperidine]-6-yl]methanesulfonamide;hydrochloride |
| SMILES | CS(=O)(=O)Nc1ccc2c(c1)[C@@H](O)CC1(CCN(C3CCc4ccccc4C3)CC1)O2.Cl |
| InChI | InChI=1S/C24H30N2O4S.ClH/c1-31(28,29)25-19-7-9-23-21(15-19)22(27)16-24(30-23)10-12-26(13-11-24)20-8-6-17-4-2-3-5-18(17)14-20;/h2-5,7,9,15,20,22,25,27H,6,8,10-14,16H2,1H3;1H/t20?,22-;/m0./s1 |
| InChIKey | KEWSPIGDPPYYTG-LCOAMIHASA-N |
| XLogP | 3.69 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.04 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |