C22H39Cl2N3O3S — CID 19045551
N-[4-(ethylamino)-1'-hexylspiro[3,4-dihydrochromene-2,4'-piperidine]-6-yl]methanesulfonamide;dihydrochloride (PubChem CID 19045551) has the molecular formula C22H39Cl2N3O3S and a molecular weight of 496.55 g/mol. Its IUPAC name is N-[4-(ethylamino)-1'-hexylspiro[3,4-dihydrochromene-2,4'-piperidine]-6-yl]methanesulfonamide;dihydrochloride.
| Compound Name | N-[4-(ethylamino)-1'-hexylspiro[3,4-dihydrochromene-2,4'-piperidine]-6-yl]methanesulfonamide;dihydrochloride |
|---|---|
| PubChem CID | 19045551 |
| Molecular Formula | C22H39Cl2N3O3S |
| Molecular Weight | 496.55 g/mol |
| Exact Mass | 495.21 |
| IUPAC Name | N-[4-(ethylamino)-1'-hexylspiro[3,4-dihydrochromene-2,4'-piperidine]-6-yl]methanesulfonamide;dihydrochloride |
| SMILES | CCCCCCN1CCC2(CC1)CC(NCC)c1cc(NS(C)(=O)=O)ccc1O2.Cl.Cl |
| InChI | InChI=1S/C22H37N3O3S.2ClH/c1-4-6-7-8-13-25-14-11-22(12-15-25)17-20(23-5-2)19-16-18(24-29(3,26)27)9-10-21(19)28-22;;/h9-10,16,20,23-24H,4-8,11-15,17H2,1-3H3;2*1H |
| InChIKey | RUMWAUBAKIZQJC-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.55 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|