C20H30N2O4S — CID 19045333
N-(1'-hexyl-4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl)methanesulfonamide (PubChem CID 19045333) has the molecular formula C20H30N2O4S and a molecular weight of 394.54 g/mol. Its IUPAC name is N-(1'-hexyl-4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl)methanesulfonamide.
| Compound Name | N-(1'-hexyl-4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl)methanesulfonamide |
|---|---|
| PubChem CID | 19045333 |
| Molecular Formula | C20H30N2O4S |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | N-(1'-hexyl-4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl)methanesulfonamide |
| SMILES | CCCCCCN1CCC2(CC1)CC(=O)c1cc(NS(C)(=O)=O)ccc1O2 |
| InChI | InChI=1S/C20H30N2O4S/c1-3-4-5-6-11-22-12-9-20(10-13-22)15-18(23)17-14-16(21-27(2,24)25)7-8-19(17)26-20/h7-8,14,21H,3-6,9-13,15H2,1-2H3 |
| InChIKey | LQBMCHRGOJITHW-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|