About N-(1'-hexyl-4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl)methanesulfonamide
N-(1'-hexyl-4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl)methanesulfonamide (PubChem CID 19045333) has the molecular formula C20H30N2O4S
and a molecular weight of 394.54 g/mol. Its IUPAC name is N-(1'-hexyl-4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl)methanesulfonamide.
Molecular Properties
| Compound Name | N-(1'-hexyl-4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl)methanesulfonamide |
| PubChem CID | 19045333 |
| Molecular Formula | C20H30N2O4S |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | N-(1'-hexyl-4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl)methanesulfonamide |
| SMILES | CCCCCCN1CCC2(CC1)CC(=O)c1cc(NS(C)(=O)=O)ccc1O2 |
| InChI | InChI=1S/C20H30N2O4S/c1-3-4-5-6-11-22-12-9-20(10-13-22)15-18(23)17-14-16(21-27(2,24)25)7-8-19(17)26-20/h7-8,14,21H,3-6,9-13,15H2,1-2H3 |
| InChIKey | LQBMCHRGOJITHW-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(1'-hexyl-4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl)methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1'-hexyl-4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl)methanesulfonamide?
The IUPAC name of N-(1'-hexyl-4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl)methanesulfonamide (CID 19045333) is N-(1'-hexyl-4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl)methanesulfonamide.
What is the SMILES notation for N-(1'-hexyl-4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl)methanesulfonamide?
The canonical SMILES for N-(1'-hexyl-4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl)methanesulfonamide is CCCCCCN1CCC2(CC1)CC(=O)c1cc(NS(C)(=O)=O)ccc1O2.
What is the InChIKey of N-(1'-hexyl-4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl)methanesulfonamide?
The InChIKey is LQBMCHRGOJITHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H30N2O4S/c1-3-4-5-6-11-22-12-9-20(10-13-22)15-18(23)17-14-16(21-27(2,24)25)7-8-19(17)26-20/h7-8,14,21H,3-6,9-13,15H2,1-2H3.
What are the key properties of N-(1'-hexyl-4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl)methanesulfonamide?
N-(1'-hexyl-4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl)methanesulfonamide has a molecular weight of 394.54 g/mol, XLogP of 3.44, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1'-hexyl-4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl)methanesulfonamide is sourced from PubChem (CID 19045333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).