C18H27N3O3S — CID 143857977
1'-[2-(2-aminoethoxy)ethyl]-6-(methylsulfanylamino)spiro[3H-chromene-2,4'-piperidine]-4-one (PubChem CID 143857977) has the molecular formula C18H27N3O3S and a molecular weight of 365.50 g/mol. Its IUPAC name is 1'-[2-(2-aminoethoxy)ethyl]-6-(methylsulfanylamino)spiro[3H-chromene-2,4'-piperidine]-4-one.
| Compound Name | 1'-[2-(2-aminoethoxy)ethyl]-6-(methylsulfanylamino)spiro[3H-chromene-2,4'-piperidine]-4-one |
|---|---|
| PubChem CID | 143857977 |
| Molecular Formula | C18H27N3O3S |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | 1'-[2-(2-aminoethoxy)ethyl]-6-(methylsulfanylamino)spiro[3H-chromene-2,4'-piperidine]-4-one |
| SMILES | CSNc1ccc2c(c1)C(=O)CC1(CCN(CCOCCN)CC1)O2 |
| InChI | InChI=1S/C18H27N3O3S/c1-25-20-14-2-3-17-15(12-14)16(22)13-18(24-17)4-7-21(8-5-18)9-11-23-10-6-19/h2-3,12,20H,4-11,13,19H2,1H3 |
| InChIKey | ZLEZHFDOEQIUSC-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|