C22H24ClN3O5 — CID 19045389
N-[1'-[(4-nitrophenyl)methyl]-4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl]acetamide;hydrochloride (PubChem CID 19045389) has the molecular formula C22H24ClN3O5 and a molecular weight of 445.90 g/mol. Its IUPAC name is N-[1'-[(4-nitrophenyl)methyl]-4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl]acetamide;hydrochloride.
| Compound Name | N-[1'-[(4-nitrophenyl)methyl]-4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 19045389 |
| Molecular Formula | C22H24ClN3O5 |
| Molecular Weight | 445.90 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | N-[1'-[(4-nitrophenyl)methyl]-4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl]acetamide;hydrochloride |
| SMILES | CC(=O)Nc1ccc2c(c1)C(=O)CC1(CCN(Cc3ccc([N+](=O)[O-])cc3)CC1)O2.Cl |
| InChI | InChI=1S/C22H23N3O5.ClH/c1-15(26)23-17-4-7-21-19(12-17)20(27)13-22(30-21)8-10-24(11-9-22)14-16-2-5-18(6-3-16)25(28)29;/h2-7,12H,8-11,13-14H2,1H3,(H,23,26);1H |
| InChIKey | SJVUPBRKFQMUBX-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.90 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|