C22H26N4O6S — CID 19045446
N-[1'-[2-(4-amino-3-nitrophenyl)ethyl]-4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl]methanesulfonamide (PubChem CID 19045446) has the molecular formula C22H26N4O6S and a molecular weight of 474.54 g/mol. Its IUPAC name is N-[1'-[2-(4-amino-3-nitrophenyl)ethyl]-4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl]methanesulfonamide.
| Compound Name | N-[1'-[2-(4-amino-3-nitrophenyl)ethyl]-4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl]methanesulfonamide |
|---|---|
| PubChem CID | 19045446 |
| Molecular Formula | C22H26N4O6S |
| Molecular Weight | 474.54 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | N-[1'-[2-(4-amino-3-nitrophenyl)ethyl]-4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc2c(c1)C(=O)CC1(CCN(CCc3ccc(N)c([N+](=O)[O-])c3)CC1)O2 |
| InChI | InChI=1S/C22H26N4O6S/c1-33(30,31)24-16-3-5-21-17(13-16)20(27)14-22(32-21)7-10-25(11-8-22)9-6-15-2-4-18(23)19(12-15)26(28)29/h2-5,12-13,24H,6-11,14,23H2,1H3 |
| InChIKey | LTVQYKWUFALSSC-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 144.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.54 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|