C24H28N2O8S — CID 19045416
oxalic acid;N-[4-[2-(4-oxospiro[3H-chromene-2,3'-piperidine]-1'-yl)ethyl]phenyl]methanesulfonamide (PubChem CID 19045416) has the molecular formula C24H28N2O8S and a molecular weight of 504.56 g/mol. Its IUPAC name is oxalic acid;N-[4-[2-(4-oxospiro[3H-chromene-2,3'-piperidine]-1'-yl)ethyl]phenyl]methanesulfonamide.
| Compound Name | oxalic acid;N-[4-[2-(4-oxospiro[3H-chromene-2,3'-piperidine]-1'-yl)ethyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 19045416 |
| Molecular Formula | C24H28N2O8S |
| Molecular Weight | 504.56 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | oxalic acid;N-[4-[2-(4-oxospiro[3H-chromene-2,3'-piperidine]-1'-yl)ethyl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc(CCN2CCCC3(CC(=O)c4ccccc4O3)C2)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C22H26N2O4S.C2H2O4/c1-29(26,27)23-18-9-7-17(8-10-18)11-14-24-13-4-12-22(16-24)15-20(25)19-5-2-3-6-21(19)28-22;3-1(4)2(5)6/h2-3,5-10,23H,4,11-16H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | IQXLMMNIHOFKBR-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 150.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.56 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|