C23H36ClNO2 — CID 12706469
1'-decylspiro[4H-isochromene-3,4'-piperidine]-1-one;hydrochloride (PubChem CID 12706469) has the molecular formula C23H36ClNO2 and a molecular weight of 394.00 g/mol. Its IUPAC name is 1'-decylspiro[4H-isochromene-3,4'-piperidine]-1-one;hydrochloride.
| Compound Name | 1'-decylspiro[4H-isochromene-3,4'-piperidine]-1-one;hydrochloride |
|---|---|
| PubChem CID | 12706469 |
| Molecular Formula | C23H36ClNO2 |
| Molecular Weight | 394.00 g/mol |
| Exact Mass | 393.24 |
| IUPAC Name | 1'-decylspiro[4H-isochromene-3,4'-piperidine]-1-one;hydrochloride |
| SMILES | CCCCCCCCCCN1CCC2(CC1)Cc1ccccc1C(=O)O2.Cl |
| InChI | InChI=1S/C23H35NO2.ClH/c1-2-3-4-5-6-7-8-11-16-24-17-14-23(15-18-24)19-20-12-9-10-13-21(20)22(25)26-23;/h9-10,12-13H,2-8,11,14-19H2,1H3;1H |
| InChIKey | ALEKZRYYJADVQP-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.00 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|