About 1'-butylspiro[4H-isochromene-3,4'-piperidine]-1-one;hydrochloride
1'-butylspiro[4H-isochromene-3,4'-piperidine]-1-one;hydrochloride (PubChem CID 12704121) has the molecular formula C17H24ClNO2
and a molecular weight of 309.84 g/mol. Its IUPAC name is 1'-butylspiro[4H-isochromene-3,4'-piperidine]-1-one;hydrochloride.
Molecular Properties
| Compound Name | 1'-butylspiro[4H-isochromene-3,4'-piperidine]-1-one;hydrochloride |
| PubChem CID | 12704121 |
| Molecular Formula | C17H24ClNO2 |
| Molecular Weight | 309.84 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 1'-butylspiro[4H-isochromene-3,4'-piperidine]-1-one;hydrochloride |
| SMILES | CCCCN1CCC2(CC1)Cc1ccccc1C(=O)O2.Cl |
| InChI | InChI=1S/C17H23NO2.ClH/c1-2-3-10-18-11-8-17(9-12-18)13-14-6-4-5-7-15(14)16(19)20-17;/h4-7H,2-3,8-13H2,1H3;1H |
| InChIKey | VJWSTIARPLENAH-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.84 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1'-butylspiro[4H-isochromene-3,4'-piperidine]-1-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-butylspiro[4H-isochromene-3,4'-piperidine]-1-one;hydrochloride?
The IUPAC name of 1'-butylspiro[4H-isochromene-3,4'-piperidine]-1-one;hydrochloride (CID 12704121) is 1'-butylspiro[4H-isochromene-3,4'-piperidine]-1-one;hydrochloride.
What is the SMILES notation for 1'-butylspiro[4H-isochromene-3,4'-piperidine]-1-one;hydrochloride?
The canonical SMILES for 1'-butylspiro[4H-isochromene-3,4'-piperidine]-1-one;hydrochloride is CCCCN1CCC2(CC1)Cc1ccccc1C(=O)O2.Cl.
What is the InChIKey of 1'-butylspiro[4H-isochromene-3,4'-piperidine]-1-one;hydrochloride?
The InChIKey is VJWSTIARPLENAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23NO2.ClH/c1-2-3-10-18-11-8-17(9-12-18)13-14-6-4-5-7-15(14)16(19)20-17;/h4-7H,2-3,8-13H2,1H3;1H.
What are the key properties of 1'-butylspiro[4H-isochromene-3,4'-piperidine]-1-one;hydrochloride?
1'-butylspiro[4H-isochromene-3,4'-piperidine]-1-one;hydrochloride has a molecular weight of 309.84 g/mol, XLogP of 3.46, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-butylspiro[4H-isochromene-3,4'-piperidine]-1-one;hydrochloride is sourced from PubChem (CID 12704121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).