C24H26N2O3 — CID 54443956
4-(4-spiro[3H-1-benzofuran-2,4'-piperidine]-1'-ylbutyl)isoindole-1,3-dione (PubChem CID 54443956) has the molecular formula C24H26N2O3 and a molecular weight of 390.48 g/mol. Its IUPAC name is 4-(4-spiro[3H-1-benzofuran-2,4'-piperidine]-1'-ylbutyl)isoindole-1,3-dione.
| Compound Name | 4-(4-spiro[3H-1-benzofuran-2,4'-piperidine]-1'-ylbutyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 54443956 |
| Molecular Formula | C24H26N2O3 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 4-(4-spiro[3H-1-benzofuran-2,4'-piperidine]-1'-ylbutyl)isoindole-1,3-dione |
| SMILES | O=C1NC(=O)c2c(CCCCN3CCC4(CC3)Cc3ccccc3O4)cccc21 |
| InChI | InChI=1S/C24H26N2O3/c27-22-19-9-5-8-17(21(19)23(28)25-22)6-3-4-13-26-14-11-24(12-15-26)16-18-7-1-2-10-20(18)29-24/h1-2,5,7-10H,3-4,6,11-16H2,(H,25,27,28) |
| InChIKey | WQDLOYKVVANNFR-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|