C15H18OS2 — CID 67705817
2,4-bis(4-methylthiophen-2-yl)pentan-3-one (PubChem CID 67705817) has the molecular formula C15H18OS2 and a molecular weight of 278.44 g/mol. Its IUPAC name is 2,4-bis(4-methylthiophen-2-yl)pentan-3-one.
| Compound Name | 2,4-bis(4-methylthiophen-2-yl)pentan-3-one |
|---|---|
| PubChem CID | 67705817 |
| Molecular Formula | C15H18OS2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 2,4-bis(4-methylthiophen-2-yl)pentan-3-one |
| SMILES | Cc1csc(C(C)C(=O)C(C)c2cc(C)cs2)c1 |
| InChI | InChI=1S/C15H18OS2/c1-9-5-13(17-7-9)11(3)15(16)12(4)14-6-10(2)8-18-14/h5-8,11-12H,1-4H3 |
| InChIKey | JEVPCSIOGDCNPB-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |