C10H14O3S2 — CID 170823289
S-[2,3-dihydroxy-3-(4-methylthiophen-2-yl)propyl] ethanethioate (PubChem CID 170823289) has the molecular formula C10H14O3S2 and a molecular weight of 246.35 g/mol. Its IUPAC name is S-[2,3-dihydroxy-3-(4-methylthiophen-2-yl)propyl] ethanethioate.
| Compound Name | S-[2,3-dihydroxy-3-(4-methylthiophen-2-yl)propyl] ethanethioate |
|---|---|
| PubChem CID | 170823289 |
| Molecular Formula | C10H14O3S2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.04 |
| IUPAC Name | S-[2,3-dihydroxy-3-(4-methylthiophen-2-yl)propyl] ethanethioate |
| SMILES | CC(=O)SCC(O)C(O)c1cc(C)cs1 |
| InChI | InChI=1S/C10H14O3S2/c1-6-3-9(15-4-6)10(13)8(12)5-14-7(2)11/h3-4,8,10,12-13H,5H2,1-2H3 |
| InChIKey | SHEQZMGNHAUIOW-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|