amino 2-(4-bromothiophen-2-yl)propanoate

C7H8BrNO2S — CID 90857194

IUPACamino 2-(4-bromothiophen-2-yl)propanoate
SMILESCC(C(=O)ON)c1cc(Br)cs1
InChIInChI=1S/C7H8BrNO2S/c1-4(7(10)11-9)6-2-5(8)3-12-6/h2-4H,9H2,1H3
InChIKeyUTLDSWDKLOCFON-UHFFFAOYSA-N
MW250.12 g/mol
LogP2.03
Rot. Bonds2

About amino 2-(4-bromothiophen-2-yl)propanoate

amino 2-(4-bromothiophen-2-yl)propanoate (PubChem CID 90857194) has the molecular formula C7H8BrNO2S and a molecular weight of 250.12 g/mol. Its IUPAC name is amino 2-(4-bromothiophen-2-yl)propanoate.

Molecular Properties

Compound Nameamino 2-(4-bromothiophen-2-yl)propanoate
PubChem CID90857194
Molecular FormulaC7H8BrNO2S
Molecular Weight250.12 g/mol
Exact Mass248.95
IUPAC Nameamino 2-(4-bromothiophen-2-yl)propanoate
SMILESCC(C(=O)ON)c1cc(Br)cs1
InChIInChI=1S/C7H8BrNO2S/c1-4(7(10)11-9)6-2-5(8)3-12-6/h2-4H,9H2,1H3
InChIKeyUTLDSWDKLOCFON-UHFFFAOYSA-N
XLogP2.03
TPSA52.32 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500250.12
LogP ≤ 52.03
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze amino 2-(4-bromothiophen-2-yl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of amino 2-(4-bromothiophen-2-yl)propanoate?
The IUPAC name of amino 2-(4-bromothiophen-2-yl)propanoate (CID 90857194) is amino 2-(4-bromothiophen-2-yl)propanoate.
What is the SMILES notation for amino 2-(4-bromothiophen-2-yl)propanoate?
The canonical SMILES for amino 2-(4-bromothiophen-2-yl)propanoate is CC(C(=O)ON)c1cc(Br)cs1.
What is the InChIKey of amino 2-(4-bromothiophen-2-yl)propanoate?
The InChIKey is UTLDSWDKLOCFON-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8BrNO2S/c1-4(7(10)11-9)6-2-5(8)3-12-6/h2-4H,9H2,1H3.
What are the key properties of amino 2-(4-bromothiophen-2-yl)propanoate?
amino 2-(4-bromothiophen-2-yl)propanoate has a molecular weight of 250.12 g/mol, XLogP of 2.03, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for amino 2-(4-bromothiophen-2-yl)propanoate is sourced from PubChem (CID 90857194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).