C13H15NO2S — CID 67707263
(3R)-4-[(4-methoxyphenyl)methylsulfanyl]oxolane-3-carbonitrile (PubChem CID 67707263) has the molecular formula C13H15NO2S and a molecular weight of 249.33 g/mol. Its IUPAC name is (3R)-4-[(4-methoxyphenyl)methylsulfanyl]oxolane-3-carbonitrile.
| Compound Name | (3R)-4-[(4-methoxyphenyl)methylsulfanyl]oxolane-3-carbonitrile |
|---|---|
| PubChem CID | 67707263 |
| Molecular Formula | C13H15NO2S |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | (3R)-4-[(4-methoxyphenyl)methylsulfanyl]oxolane-3-carbonitrile |
| SMILES | COc1ccc(CSC2COC[C@H]2C#N)cc1 |
| InChI | InChI=1S/C13H15NO2S/c1-15-12-4-2-10(3-5-12)9-17-13-8-16-7-11(13)6-14/h2-5,11,13H,7-9H2,1H3/t11-,13?/m1/s1 |
| InChIKey | QVUTURVHQLOEEZ-JTDNENJMSA-N |
| XLogP | 2.47 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |