C6H11NO8 — CID 67707538
[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] nitrate (PubChem CID 67707538) has the molecular formula C6H11NO8 and a molecular weight of 225.15 g/mol. Its IUPAC name is [(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] nitrate.
| Compound Name | [(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] nitrate |
|---|---|
| PubChem CID | 67707538 |
| Molecular Formula | C6H11NO8 |
| Molecular Weight | 225.15 g/mol |
| Exact Mass | 225.05 |
| IUPAC Name | [(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] nitrate |
| SMILES | O=[N+]([O-])OC1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C6H11NO8/c8-1-2-3(9)4(10)5(11)6(14-2)15-7(12)13/h2-6,8-11H,1H2/t2-,3+,4+,5-,6?/m1/s1 |
| InChIKey | MPECSCPZUUUPEU-SVZMEOIVSA-N |
| XLogP | -3.01 |
| TPSA | 142.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.15 |
| LogP ≤ 5 | -3.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|