C6H13NO9 — CID 141402236
(2S,3S,4S,5S,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol;nitric acid (PubChem CID 141402236) has the molecular formula C6H13NO9 and a molecular weight of 243.17 g/mol. Its IUPAC name is (2S,3S,4S,5S,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol;nitric acid.
| Compound Name | (2S,3S,4S,5S,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol;nitric acid |
|---|---|
| PubChem CID | 141402236 |
| Molecular Formula | C6H13NO9 |
| Molecular Weight | 243.17 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | (2S,3S,4S,5S,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol;nitric acid |
| SMILES | O=[N+]([O-])O.OC[C@H]1O[C@H](O)[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H12O6.HNO3/c7-1-2-3(8)4(9)5(10)6(11)12-2;2-1(3)4/h2-11H,1H2;(H,2,3,4)/t2-,3-,4+,5+,6+;/m1./s1 |
| InChIKey | AOFVLRFQBZKQIG-XECIQJBQSA-N |
| XLogP | -3.57 |
| TPSA | 173.75 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.17 |
| LogP ≤ 5 | -3.57 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|