C24H31N3O3 — CID 67708219
N-[2-[2-(2,3-dihydro-1,4-benzodioxin-3-yl)ethylamino]ethyl]-N-pyridin-2-ylcyclohexanecarboxamide (PubChem CID 67708219) has the molecular formula C24H31N3O3 and a molecular weight of 409.53 g/mol. Its IUPAC name is N-[2-[2-(2,3-dihydro-1,4-benzodioxin-3-yl)ethylamino]ethyl]-N-pyridin-2-ylcyclohexanecarboxamide.
| Compound Name | N-[2-[2-(2,3-dihydro-1,4-benzodioxin-3-yl)ethylamino]ethyl]-N-pyridin-2-ylcyclohexanecarboxamide |
|---|---|
| PubChem CID | 67708219 |
| Molecular Formula | C24H31N3O3 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | N-[2-[2-(2,3-dihydro-1,4-benzodioxin-3-yl)ethylamino]ethyl]-N-pyridin-2-ylcyclohexanecarboxamide |
| SMILES | O=C(C1CCCCC1)N(CCNCCC1COc2ccccc2O1)c1ccccn1 |
| InChI | InChI=1S/C24H31N3O3/c28-24(19-8-2-1-3-9-19)27(23-12-6-7-14-26-23)17-16-25-15-13-20-18-29-21-10-4-5-11-22(21)30-20/h4-7,10-12,14,19-20,25H,1-3,8-9,13,15-18H2 |
| InChIKey | AMJZXMDNDRPQBG-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|