C14H14N2O6 — CID 67708982
3,4-dihydroxy-1-(2-hydroxyethyl)-5-[(4-nitrophenyl)methyl]pyridin-2-one (PubChem CID 67708982) has the molecular formula C14H14N2O6 and a molecular weight of 306.27 g/mol. Its IUPAC name is 3,4-dihydroxy-1-(2-hydroxyethyl)-5-[(4-nitrophenyl)methyl]pyridin-2-one.
| Compound Name | 3,4-dihydroxy-1-(2-hydroxyethyl)-5-[(4-nitrophenyl)methyl]pyridin-2-one |
|---|---|
| PubChem CID | 67708982 |
| Molecular Formula | C14H14N2O6 |
| Molecular Weight | 306.27 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 3,4-dihydroxy-1-(2-hydroxyethyl)-5-[(4-nitrophenyl)methyl]pyridin-2-one |
| SMILES | O=c1c(O)c(O)c(Cc2ccc([N+](=O)[O-])cc2)cn1CCO |
| InChI | InChI=1S/C14H14N2O6/c17-6-5-15-8-10(12(18)13(19)14(15)20)7-9-1-3-11(4-2-9)16(21)22/h1-4,8,17-19H,5-7H2 |
| InChIKey | YDISWSSPHXRPOG-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 125.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.27 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|