C19H38NO7P — CID 67709823
2-amino-2-(hydroxymethyl)propane-1,3-diol;nonyl dihydrogen phosphite;phenol (PubChem CID 67709823) has the molecular formula C19H38NO7P and a molecular weight of 423.49 g/mol. Its IUPAC name is 2-amino-2-(hydroxymethyl)propane-1,3-diol;nonyl dihydrogen phosphite;phenol.
| Compound Name | 2-amino-2-(hydroxymethyl)propane-1,3-diol;nonyl dihydrogen phosphite;phenol |
|---|---|
| PubChem CID | 67709823 |
| Molecular Formula | C19H38NO7P |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | 2-amino-2-(hydroxymethyl)propane-1,3-diol;nonyl dihydrogen phosphite;phenol |
| SMILES | CCCCCCCCCOP(O)O.NC(CO)(CO)CO.Oc1ccccc1 |
| InChI | InChI=1S/C9H21O3P.C6H6O.C4H11NO3/c1-2-3-4-5-6-7-8-9-12-13(10)11;7-6-4-2-1-3-5-6;5-4(1-6,2-7)3-8/h10-11H,2-9H2,1H3;1-5,7H;6-8H,1-3,5H2 |
| InChIKey | QUZQUHAIFLFGIN-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 156.63 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|