C12H22NO6P — CID 70583726
2-amino-2-(hydroxymethyl)propane-1,3-diol;2-phenylethyl dihydrogen phosphite (PubChem CID 70583726) has the molecular formula C12H22NO6P and a molecular weight of 307.28 g/mol. Its IUPAC name is 2-amino-2-(hydroxymethyl)propane-1,3-diol;2-phenylethyl dihydrogen phosphite.
| Compound Name | 2-amino-2-(hydroxymethyl)propane-1,3-diol;2-phenylethyl dihydrogen phosphite |
|---|---|
| PubChem CID | 70583726 |
| Molecular Formula | C12H22NO6P |
| Molecular Weight | 307.28 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 2-amino-2-(hydroxymethyl)propane-1,3-diol;2-phenylethyl dihydrogen phosphite |
| SMILES | NC(CO)(CO)CO.OP(O)OCCc1ccccc1 |
| InChI | InChI=1S/C8H11O3P.C4H11NO3/c9-12(10)11-7-6-8-4-2-1-3-5-8;5-4(1-6,2-7)3-8/h1-5,9-10H,6-7H2;6-8H,1-3,5H2 |
| InChIKey | NMTDBUVXDKHKJZ-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 136.40 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.28 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|