C26H31FO6 — CID 67710680
[2-[(8S,9R,10S,13S,14S,16S,17R)-17-acetyloxy-9-fluoro-10,13,16-trimethyl-3-oxo-6,7,8,14,15,16-hexahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate (PubChem CID 67710680) has the molecular formula C26H31FO6 and a molecular weight of 458.53 g/mol. Its IUPAC name is [2-[(8S,9R,10S,13S,14S,16S,17R)-17-acetyloxy-9-fluoro-10,13,16-trimethyl-3-oxo-6,7,8,14,15,16-hexahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate.
| Compound Name | [2-[(8S,9R,10S,13S,14S,16S,17R)-17-acetyloxy-9-fluoro-10,13,16-trimethyl-3-oxo-6,7,8,14,15,16-hexahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 67710680 |
| Molecular Formula | C26H31FO6 |
| Molecular Weight | 458.53 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | [2-[(8S,9R,10S,13S,14S,16S,17R)-17-acetyloxy-9-fluoro-10,13,16-trimethyl-3-oxo-6,7,8,14,15,16-hexahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate |
| SMILES | CC(=O)OCC(=O)[C@@]1(OC(C)=O)[C@@H](C)C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@@]3(F)C=C[C@@]21C |
| InChI | InChI=1S/C26H31FO6/c1-15-12-21-20-7-6-18-13-19(30)8-9-23(18,4)25(20,27)11-10-24(21,5)26(15,33-17(3)29)22(31)14-32-16(2)28/h8-11,13,15,20-21H,6-7,12,14H2,1-5H3/t15-,20-,21-,23-,24-,25+,26-/m0/s1 |
| InChIKey | UKMWWXAVHMQESP-VAGFXLEVSA-N |
| XLogP | 3.84 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.53 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|