C21H29NO4Si — CID 67712298
methyl (3S,4aS,8aR)-2-benzyl-1-oxo-6-trimethylsilyloxy-3,4,4a,7,8,8a-hexahydroisoquinoline-3-carboxylate (PubChem CID 67712298) has the molecular formula C21H29NO4Si and a molecular weight of 387.55 g/mol. Its IUPAC name is methyl (3S,4aS,8aR)-2-benzyl-1-oxo-6-trimethylsilyloxy-3,4,4a,7,8,8a-hexahydroisoquinoline-3-carboxylate.
| Compound Name | methyl (3S,4aS,8aR)-2-benzyl-1-oxo-6-trimethylsilyloxy-3,4,4a,7,8,8a-hexahydroisoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 67712298 |
| Molecular Formula | C21H29NO4Si |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | methyl (3S,4aS,8aR)-2-benzyl-1-oxo-6-trimethylsilyloxy-3,4,4a,7,8,8a-hexahydroisoquinoline-3-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@H]2C=C(O[Si](C)(C)C)CC[C@H]2C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C21H29NO4Si/c1-25-21(24)19-13-16-12-17(26-27(2,3)4)10-11-18(16)20(23)22(19)14-15-8-6-5-7-9-15/h5-9,12,16,18-19H,10-11,13-14H2,1-4H3/t16-,18-,19+/m1/s1 |
| InChIKey | HDTNLLPNIDMRHY-QRQLOZEOSA-N |
| XLogP | 3.72 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|