C12H20N2O7 — CID 67713087
1-hydroxypyrrolidine-2,5-dione;(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (PubChem CID 67713087) has the molecular formula C12H20N2O7 and a molecular weight of 304.30 g/mol. Its IUPAC name is 1-hydroxypyrrolidine-2,5-dione;(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid.
| Compound Name | 1-hydroxypyrrolidine-2,5-dione;(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| PubChem CID | 67713087 |
| Molecular Formula | C12H20N2O7 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 1-hydroxypyrrolidine-2,5-dione;(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| SMILES | C[C@H](NC(=O)OC(C)(C)C)C(=O)O.O=C1CCC(=O)N1O |
| InChI | InChI=1S/C8H15NO4.C4H5NO3/c1-5(6(10)11)9-7(12)13-8(2,3)4;6-3-1-2-4(7)5(3)8/h5H,1-4H3,(H,9,12)(H,10,11);8H,1-2H2/t5-;/m0./s1 |
| InChIKey | FZVJGLXSIWZCPO-JEDNCBNOSA-N |
| XLogP | 0.51 |
| TPSA | 133.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|