C24H28N2O5 — CID 67715791
5-amino-3-ethoxy-6-[(4-methoxyphenyl)methyl]-8-methyl-2-morpholin-4-ylchromen-4-one (PubChem CID 67715791) has the molecular formula C24H28N2O5 and a molecular weight of 424.50 g/mol. Its IUPAC name is 5-amino-3-ethoxy-6-[(4-methoxyphenyl)methyl]-8-methyl-2-morpholin-4-ylchromen-4-one.
| Compound Name | 5-amino-3-ethoxy-6-[(4-methoxyphenyl)methyl]-8-methyl-2-morpholin-4-ylchromen-4-one |
|---|---|
| PubChem CID | 67715791 |
| Molecular Formula | C24H28N2O5 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | 5-amino-3-ethoxy-6-[(4-methoxyphenyl)methyl]-8-methyl-2-morpholin-4-ylchromen-4-one |
| SMILES | CCOc1c(N2CCOCC2)oc2c(C)cc(Cc3ccc(OC)cc3)c(N)c2c1=O |
| InChI | InChI=1S/C24H28N2O5/c1-4-30-23-21(27)19-20(25)17(14-16-5-7-18(28-3)8-6-16)13-15(2)22(19)31-24(23)26-9-11-29-12-10-26/h5-8,13H,4,9-12,14,25H2,1-3H3 |
| InChIKey | ZNYBUXNXZQMIRA-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 87.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|