About 2-[2-(4,5-dihydroimidazol-1-yl)phenyl]pyrimidine
2-[2-(4,5-dihydroimidazol-1-yl)phenyl]pyrimidine (PubChem CID 67717157) has the molecular formula C13H12N4
and a molecular weight of 224.27 g/mol. Its IUPAC name is 2-[2-(4,5-dihydroimidazol-1-yl)phenyl]pyrimidine.
Molecular Properties
| Compound Name | 2-[2-(4,5-dihydroimidazol-1-yl)phenyl]pyrimidine |
| PubChem CID | 67717157 |
| Molecular Formula | C13H12N4 |
| Molecular Weight | 224.27 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 2-[2-(4,5-dihydroimidazol-1-yl)phenyl]pyrimidine |
| SMILES | C1=NCCN1c1ccccc1-c1ncccn1 |
| InChI | InChI=1S/C13H12N4/c1-2-5-12(17-9-8-14-10-17)11(4-1)13-15-6-3-7-16-13/h1-7,10H,8-9H2 |
| InChIKey | LJNGWTFZQNUTEF-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 41.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.27 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2-(4,5-dihydroimidazol-1-yl)phenyl]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(4,5-dihydroimidazol-1-yl)phenyl]pyrimidine?
The IUPAC name of 2-[2-(4,5-dihydroimidazol-1-yl)phenyl]pyrimidine (CID 67717157) is 2-[2-(4,5-dihydroimidazol-1-yl)phenyl]pyrimidine.
What is the SMILES notation for 2-[2-(4,5-dihydroimidazol-1-yl)phenyl]pyrimidine?
The canonical SMILES for 2-[2-(4,5-dihydroimidazol-1-yl)phenyl]pyrimidine is C1=NCCN1c1ccccc1-c1ncccn1.
What is the InChIKey of 2-[2-(4,5-dihydroimidazol-1-yl)phenyl]pyrimidine?
The InChIKey is LJNGWTFZQNUTEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N4/c1-2-5-12(17-9-8-14-10-17)11(4-1)13-15-6-3-7-16-13/h1-7,10H,8-9H2.
What are the key properties of 2-[2-(4,5-dihydroimidazol-1-yl)phenyl]pyrimidine?
2-[2-(4,5-dihydroimidazol-1-yl)phenyl]pyrimidine has a molecular weight of 224.27 g/mol, XLogP of 1.99, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(4,5-dihydroimidazol-1-yl)phenyl]pyrimidine is sourced from PubChem (CID 67717157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).