C16H25N5O — CID 67717702
2-N-(6-aminohexyl)-8-methoxy-4-N-methylquinazoline-2,4-diamine (PubChem CID 67717702) has the molecular formula C16H25N5O and a molecular weight of 303.41 g/mol. Its IUPAC name is 2-N-(6-aminohexyl)-8-methoxy-4-N-methylquinazoline-2,4-diamine.
| Compound Name | 2-N-(6-aminohexyl)-8-methoxy-4-N-methylquinazoline-2,4-diamine |
|---|---|
| PubChem CID | 67717702 |
| Molecular Formula | C16H25N5O |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.21 |
| IUPAC Name | 2-N-(6-aminohexyl)-8-methoxy-4-N-methylquinazoline-2,4-diamine |
| SMILES | CNc1nc(NCCCCCCN)nc2c(OC)cccc12 |
| InChI | InChI=1S/C16H25N5O/c1-18-15-12-8-7-9-13(22-2)14(12)20-16(21-15)19-11-6-4-3-5-10-17/h7-9H,3-6,10-11,17H2,1-2H3,(H2,18,19,20,21) |
| InChIKey | FBOIXRNSTBGWHU-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|