C14H12OS3 — CID 67722514
1-(2,5-dithiophen-2-yl-3H-thiophen-2-yl)ethanone (PubChem CID 67722514) has the molecular formula C14H12OS3 and a molecular weight of 292.45 g/mol. Its IUPAC name is 1-(2,5-dithiophen-2-yl-3H-thiophen-2-yl)ethanone.
| Compound Name | 1-(2,5-dithiophen-2-yl-3H-thiophen-2-yl)ethanone |
|---|---|
| PubChem CID | 67722514 |
| Molecular Formula | C14H12OS3 |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.01 |
| IUPAC Name | 1-(2,5-dithiophen-2-yl-3H-thiophen-2-yl)ethanone |
| SMILES | CC(=O)C1(c2cccs2)CC=C(c2cccs2)S1 |
| InChI | InChI=1S/C14H12OS3/c1-10(15)14(13-5-3-9-17-13)7-6-12(18-14)11-4-2-8-16-11/h2-6,8-9H,7H2,1H3 |
| InChIKey | KTQIVHSCOFMTAY-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |