About benzyl 3-amino-3-(5-methyl-4-oxo-6-phenylthieno[2,3-d][1,3]oxazin-2-yl)propanoate
benzyl 3-amino-3-(5-methyl-4-oxo-6-phenylthieno[2,3-d][1,3]oxazin-2-yl)propanoate (PubChem CID 67724155) has the molecular formula C23H20N2O4S
and a molecular weight of 420.49 g/mol. Its IUPAC name is benzyl 3-amino-3-(5-methyl-4-oxo-6-phenylthieno[2,3-d][1,3]oxazin-2-yl)propanoate.
Molecular Properties
| Compound Name | benzyl 3-amino-3-(5-methyl-4-oxo-6-phenylthieno[2,3-d][1,3]oxazin-2-yl)propanoate |
| PubChem CID | 67724155 |
| Molecular Formula | C23H20N2O4S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | benzyl 3-amino-3-(5-methyl-4-oxo-6-phenylthieno[2,3-d][1,3]oxazin-2-yl)propanoate |
| SMILES | Cc1c(-c2ccccc2)sc2nc(C(N)CC(=O)OCc3ccccc3)oc(=O)c12 |
| InChI | InChI=1S/C23H20N2O4S/c1-14-19-22(30-20(14)16-10-6-3-7-11-16)25-21(29-23(19)27)17(24)12-18(26)28-13-15-8-4-2-5-9-15/h2-11,17H,12-13,24H2,1H3 |
| InChIKey | VSYXNIISMCOVJJ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze benzyl 3-amino-3-(5-methyl-4-oxo-6-phenylthieno[2,3-d][1,3]oxazin-2-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 3-amino-3-(5-methyl-4-oxo-6-phenylthieno[2,3-d][1,3]oxazin-2-yl)propanoate?
The IUPAC name of benzyl 3-amino-3-(5-methyl-4-oxo-6-phenylthieno[2,3-d][1,3]oxazin-2-yl)propanoate (CID 67724155) is benzyl 3-amino-3-(5-methyl-4-oxo-6-phenylthieno[2,3-d][1,3]oxazin-2-yl)propanoate.
What is the SMILES notation for benzyl 3-amino-3-(5-methyl-4-oxo-6-phenylthieno[2,3-d][1,3]oxazin-2-yl)propanoate?
The canonical SMILES for benzyl 3-amino-3-(5-methyl-4-oxo-6-phenylthieno[2,3-d][1,3]oxazin-2-yl)propanoate is Cc1c(-c2ccccc2)sc2nc(C(N)CC(=O)OCc3ccccc3)oc(=O)c12.
What is the InChIKey of benzyl 3-amino-3-(5-methyl-4-oxo-6-phenylthieno[2,3-d][1,3]oxazin-2-yl)propanoate?
The InChIKey is VSYXNIISMCOVJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20N2O4S/c1-14-19-22(30-20(14)16-10-6-3-7-11-16)25-21(29-23(19)27)17(24)12-18(26)28-13-15-8-4-2-5-9-15/h2-11,17H,12-13,24H2,1H3.
What are the key properties of benzyl 3-amino-3-(5-methyl-4-oxo-6-phenylthieno[2,3-d][1,3]oxazin-2-yl)propanoate?
benzyl 3-amino-3-(5-methyl-4-oxo-6-phenylthieno[2,3-d][1,3]oxazin-2-yl)propanoate has a molecular weight of 420.49 g/mol, XLogP of 4.36, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 3-amino-3-(5-methyl-4-oxo-6-phenylthieno[2,3-d][1,3]oxazin-2-yl)propanoate is sourced from PubChem (CID 67724155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).