C19H20N2O3S — CID 67726112
1'-[2-(4-nitrophenyl)ethyl]spiro[1,3-benzoxathiole-2,4'-piperidine] (PubChem CID 67726112) has the molecular formula C19H20N2O3S and a molecular weight of 356.45 g/mol. Its IUPAC name is 1'-[2-(4-nitrophenyl)ethyl]spiro[1,3-benzoxathiole-2,4'-piperidine].
| Compound Name | 1'-[2-(4-nitrophenyl)ethyl]spiro[1,3-benzoxathiole-2,4'-piperidine] |
|---|---|
| PubChem CID | 67726112 |
| Molecular Formula | C19H20N2O3S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 1'-[2-(4-nitrophenyl)ethyl]spiro[1,3-benzoxathiole-2,4'-piperidine] |
| SMILES | O=[N+]([O-])c1ccc(CCN2CCC3(CC2)Oc2ccccc2S3)cc1 |
| InChI | InChI=1S/C19H20N2O3S/c22-21(23)16-7-5-15(6-8-16)9-12-20-13-10-19(11-14-20)24-17-3-1-2-4-18(17)25-19/h1-8H,9-14H2 |
| InChIKey | DBRAAUHGMOFGKM-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|