C24H28N2O8 — CID 13476081
2-methyl-1'-[2-(4-nitrophenyl)ethyl]spiro[2,5-dihydro-1,4-benzodioxepine-3,4'-piperidine];oxalic acid (PubChem CID 13476081) has the molecular formula C24H28N2O8 and a molecular weight of 472.49 g/mol. Its IUPAC name is 2-methyl-1'-[2-(4-nitrophenyl)ethyl]spiro[2,5-dihydro-1,4-benzodioxepine-3,4'-piperidine];oxalic acid.
| Compound Name | 2-methyl-1'-[2-(4-nitrophenyl)ethyl]spiro[2,5-dihydro-1,4-benzodioxepine-3,4'-piperidine];oxalic acid |
|---|---|
| PubChem CID | 13476081 |
| Molecular Formula | C24H28N2O8 |
| Molecular Weight | 472.49 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | 2-methyl-1'-[2-(4-nitrophenyl)ethyl]spiro[2,5-dihydro-1,4-benzodioxepine-3,4'-piperidine];oxalic acid |
| SMILES | CC1Oc2ccccc2COC12CCN(CCc1ccc([N+](=O)[O-])cc1)CC2.O=C(O)C(=O)O |
| InChI | InChI=1S/C22H26N2O4.C2H2O4/c1-17-22(27-16-19-4-2-3-5-21(19)28-17)11-14-23(15-12-22)13-10-18-6-8-20(9-7-18)24(25)26;3-1(4)2(5)6/h2-9,17H,10-16H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | JQSMFNIGLHLHHR-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 139.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.49 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|