C22H28N2O5 — CID 71439946
2-methyl-1-[2-(4-nitrophenyl)ethyl]-3-phenylpyrrolidin-3-ol;propanoic acid (PubChem CID 71439946) has the molecular formula C22H28N2O5 and a molecular weight of 400.48 g/mol. Its IUPAC name is 2-methyl-1-[2-(4-nitrophenyl)ethyl]-3-phenylpyrrolidin-3-ol;propanoic acid.
| Compound Name | 2-methyl-1-[2-(4-nitrophenyl)ethyl]-3-phenylpyrrolidin-3-ol;propanoic acid |
|---|---|
| PubChem CID | 71439946 |
| Molecular Formula | C22H28N2O5 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | 2-methyl-1-[2-(4-nitrophenyl)ethyl]-3-phenylpyrrolidin-3-ol;propanoic acid |
| SMILES | CC1N(CCc2ccc([N+](=O)[O-])cc2)CCC1(O)c1ccccc1.CCC(=O)O |
| InChI | InChI=1S/C19H22N2O3.C3H6O2/c1-15-19(22,17-5-3-2-4-6-17)12-14-20(15)13-11-16-7-9-18(10-8-16)21(23)24;1-2-3(4)5/h2-10,15,22H,11-14H2,1H3;2H2,1H3,(H,4,5) |
| InChIKey | ASQVKNDMNNAWOS-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 103.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|