C28H24N6O3S — CID 67727921
2-[2-[(4-ethyl-7-phenyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-13-yl)-methylcarbamoyl]indol-1-yl]acetic acid (PubChem CID 67727921) has the molecular formula C28H24N6O3S and a molecular weight of 524.61 g/mol. Its IUPAC name is 2-[2-[(4-ethyl-7-phenyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-13-yl)-methylcarbamoyl]indol-1-yl]acetic acid.
| Compound Name | 2-[2-[(4-ethyl-7-phenyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-13-yl)-methylcarbamoyl]indol-1-yl]acetic acid |
|---|---|
| PubChem CID | 67727921 |
| Molecular Formula | C28H24N6O3S |
| Molecular Weight | 524.61 g/mol |
| Exact Mass | 524.16 |
| IUPAC Name | 2-[2-[(4-ethyl-7-phenyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-13-yl)-methylcarbamoyl]indol-1-yl]acetic acid |
| SMILES | CCc1cc2c(s1)-n1c(nnc1N(C)C(=O)c1cc3ccccc3n1CC(=O)O)CN=C2c1ccccc1 |
| InChI | InChI=1S/C28H24N6O3S/c1-3-19-14-20-25(17-9-5-4-6-10-17)29-15-23-30-31-28(34(23)27(20)38-19)32(2)26(37)22-13-18-11-7-8-12-21(18)33(22)16-24(35)36/h4-14H,3,15-16H2,1-2H3,(H,35,36) |
| InChIKey | BXOJDUZKZWRGAS-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 105.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.61 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |