C15H22N2O6 — CID 67729874
(2R)-1-[(2S)-2-(carboxymethylideneamino)propanoyl]-2-(oxan-4-yl)pyrrolidine-2-carboxylic acid (PubChem CID 67729874) has the molecular formula C15H22N2O6 and a molecular weight of 326.35 g/mol. Its IUPAC name is (2R)-1-[(2S)-2-(carboxymethylideneamino)propanoyl]-2-(oxan-4-yl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-1-[(2S)-2-(carboxymethylideneamino)propanoyl]-2-(oxan-4-yl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 67729874 |
| Molecular Formula | C15H22N2O6 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | (2R)-1-[(2S)-2-(carboxymethylideneamino)propanoyl]-2-(oxan-4-yl)pyrrolidine-2-carboxylic acid |
| SMILES | C[C@H](/N=C/C(=O)O)C(=O)N1CCC[C@]1(C(=O)O)C1CCOCC1 |
| InChI | InChI=1S/C15H22N2O6/c1-10(16-9-12(18)19)13(20)17-6-2-5-15(17,14(21)22)11-3-7-23-8-4-11/h9-11H,2-8H2,1H3,(H,18,19)(H,21,22)/b16-9+/t10-,15+/m0/s1 |
| InChIKey | JLDQQSCIMMREBD-ACZYDCLYSA-N |
| XLogP | 0.40 |
| TPSA | 116.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|