C40H40N2O7S2 — CID 67730559
3-[3-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfonylsulfanylpropyl]amino]phenoxy]benzoic acid (PubChem CID 67730559) has the molecular formula C40H40N2O7S2 and a molecular weight of 724.90 g/mol. Its IUPAC name is 3-[3-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfonylsulfanylpropyl]amino]phenoxy]benzoic acid.
| Compound Name | 3-[3-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfonylsulfanylpropyl]amino]phenoxy]benzoic acid |
|---|---|
| PubChem CID | 67730559 |
| Molecular Formula | C40H40N2O7S2 |
| Molecular Weight | 724.90 g/mol |
| Exact Mass | 724.23 |
| IUPAC Name | 3-[3-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfonylsulfanylpropyl]amino]phenoxy]benzoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@H](CNc1cccc(Oc2cccc(C(=O)O)c2)c1)CSS(=O)(=O)C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H40N2O7S2/c1-39(2,3)49-38(45)42-34(27-41-33-22-14-24-36(26-33)48-35-23-13-15-29(25-35)37(43)44)28-50-51(46,47)40(30-16-7-4-8-17-30,31-18-9-5-10-19-31)32-20-11-6-12-21-32/h4-26,34,41H,27-28H2,1-3H3,(H,42,45)(H,43,44)/t34-/m1/s1 |
| InChIKey | QIRDBHKQELNAOW-UUWRZZSWSA-N |
| XLogP | 8.54 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.90 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|