C24H29NO3 — CID 67730578
1-[2-[(9-methyl-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)oxy]ethyl]piperidine-3-carboxylic acid (PubChem CID 67730578) has the molecular formula C24H29NO3 and a molecular weight of 379.50 g/mol. Its IUPAC name is 1-[2-[(9-methyl-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)oxy]ethyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[2-[(9-methyl-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)oxy]ethyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 67730578 |
| Molecular Formula | C24H29NO3 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | 1-[2-[(9-methyl-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)oxy]ethyl]piperidine-3-carboxylic acid |
| SMILES | CC1Cc2ccccc2C(OCCN2CCCC(C(=O)O)C2)c2ccccc21 |
| InChI | InChI=1S/C24H29NO3/c1-17-15-18-7-2-3-10-21(18)23(22-11-5-4-9-20(17)22)28-14-13-25-12-6-8-19(16-25)24(26)27/h2-5,7,9-11,17,19,23H,6,8,12-16H2,1H3,(H,26,27) |
| InChIKey | MWXQCPOAGWTIHL-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |