C15H23Cl2O5P — CID 67736659
[2,3-dichloro-4-(3-pentoxyphenoxy)butyl] dihydrogen phosphite (PubChem CID 67736659) has the molecular formula C15H23Cl2O5P and a molecular weight of 385.22 g/mol. Its IUPAC name is [2,3-dichloro-4-(3-pentoxyphenoxy)butyl] dihydrogen phosphite.
| Compound Name | [2,3-dichloro-4-(3-pentoxyphenoxy)butyl] dihydrogen phosphite |
|---|---|
| PubChem CID | 67736659 |
| Molecular Formula | C15H23Cl2O5P |
| Molecular Weight | 385.22 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | [2,3-dichloro-4-(3-pentoxyphenoxy)butyl] dihydrogen phosphite |
| SMILES | CCCCCOc1cccc(OCC(Cl)C(Cl)COP(O)O)c1 |
| InChI | InChI=1S/C15H23Cl2O5P/c1-2-3-4-8-20-12-6-5-7-13(9-12)21-10-14(16)15(17)11-22-23(18)19/h5-7,9,14-15,18-19H,2-4,8,10-11H2,1H3 |
| InChIKey | FYHTXBCNFSGPEA-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.22 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|