C16H25Cl2O5P — CID 67736809
[2,3-dichloro-4-(3-methyl-5-pentoxyphenoxy)butyl] dihydrogen phosphite (PubChem CID 67736809) has the molecular formula C16H25Cl2O5P and a molecular weight of 399.25 g/mol. Its IUPAC name is [2,3-dichloro-4-(3-methyl-5-pentoxyphenoxy)butyl] dihydrogen phosphite.
| Compound Name | [2,3-dichloro-4-(3-methyl-5-pentoxyphenoxy)butyl] dihydrogen phosphite |
|---|---|
| PubChem CID | 67736809 |
| Molecular Formula | C16H25Cl2O5P |
| Molecular Weight | 399.25 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | [2,3-dichloro-4-(3-methyl-5-pentoxyphenoxy)butyl] dihydrogen phosphite |
| SMILES | CCCCCOc1cc(C)cc(OCC(Cl)C(Cl)COP(O)O)c1 |
| InChI | InChI=1S/C16H25Cl2O5P/c1-3-4-5-6-21-13-7-12(2)8-14(9-13)22-10-15(17)16(18)11-23-24(19)20/h7-9,15-16,19-20H,3-6,10-11H2,1-2H3 |
| InChIKey | ILDKTZKIWHPBPZ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.25 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|