C28H24O9 — CID 67740333
5-[(3R)-3-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-3-hydroxypropylidene]-4,4-di(prop-2-enoyl)nona-1,8-diene-3,7-dione (PubChem CID 67740333) has the molecular formula C28H24O9 and a molecular weight of 504.49 g/mol. Its IUPAC name is 5-[(3R)-3-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-3-hydroxypropylidene]-4,4-di(prop-2-enoyl)nona-1,8-diene-3,7-dione.
| Compound Name | 5-[(3R)-3-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-3-hydroxypropylidene]-4,4-di(prop-2-enoyl)nona-1,8-diene-3,7-dione |
|---|---|
| PubChem CID | 67740333 |
| Molecular Formula | C28H24O9 |
| Molecular Weight | 504.49 g/mol |
| Exact Mass | 504.14 |
| IUPAC Name | 5-[(3R)-3-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-3-hydroxypropylidene]-4,4-di(prop-2-enoyl)nona-1,8-diene-3,7-dione |
| SMILES | C=CC(=O)CC(=CC[C@@H](O)C1=CC(=O)c2c(O)ccc(O)c2C1=O)C(C(=O)C=C)(C(=O)C=C)C(=O)C=C |
| InChI | InChI=1S/C28H24O9/c1-5-16(29)13-15(28(22(34)6-2,23(35)7-3)24(36)8-4)9-10-18(30)17-14-21(33)25-19(31)11-12-20(32)26(25)27(17)37/h5-9,11-12,14,18,30-32H,1-4,10,13H2/t18-/m1/s1 |
| InChIKey | DNGORIYYHUATRG-GOSISDBHSA-N |
| XLogP | 2.48 |
| TPSA | 163.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.49 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_D(1)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|