C26H31N5O4 — CID 67741876
4-nitro-N-[4-[[4-(2-oxo-3H-benzimidazol-1-yl)piperidin-1-yl]methyl]cyclohexyl]benzamide (PubChem CID 67741876) has the molecular formula C26H31N5O4 and a molecular weight of 477.57 g/mol. Its IUPAC name is 4-nitro-N-[4-[[4-(2-oxo-3H-benzimidazol-1-yl)piperidin-1-yl]methyl]cyclohexyl]benzamide.
| Compound Name | 4-nitro-N-[4-[[4-(2-oxo-3H-benzimidazol-1-yl)piperidin-1-yl]methyl]cyclohexyl]benzamide |
|---|---|
| PubChem CID | 67741876 |
| Molecular Formula | C26H31N5O4 |
| Molecular Weight | 477.57 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | 4-nitro-N-[4-[[4-(2-oxo-3H-benzimidazol-1-yl)piperidin-1-yl]methyl]cyclohexyl]benzamide |
| SMILES | O=C(NC1CCC(CN2CCC(n3c(=O)[nH]c4ccccc43)CC2)CC1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H31N5O4/c32-25(19-7-11-22(12-8-19)31(34)35)27-20-9-5-18(6-10-20)17-29-15-13-21(14-16-29)30-24-4-2-1-3-23(24)28-26(30)33/h1-4,7-8,11-12,18,20-21H,5-6,9-10,13-17H2,(H,27,32)(H,28,33) |
| InChIKey | UGWKLRLGNLXPDY-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 113.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.57 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|