About CID 67744979
CID 67744979 (PubChem CID 67744979) has the molecular formula C8H7O2Si
and a molecular weight of 163.23 g/mol.
Molecular Properties
| Compound Name | CID 67744979 |
| PubChem CID | 67744979 |
| Molecular Formula | C8H7O2Si |
| Molecular Weight | 163.23 g/mol |
| Exact Mass | 163.02 |
| IUPAC Name | — |
| SMILES | Oc1ccccc1/C=C/O[Si] |
| InChI | InChI=1S/C8H7O2Si/c9-8-4-2-1-3-7(8)5-6-10-11/h1-6,9H/b6-5+ |
| InChIKey | OUMLSXISVALKIH-AATRIKPKSA-N |
| XLogP | 1.46 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.23 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 67744979 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 67744979?
The IUPAC name of CID 67744979 (CID 67744979) is not available.
What is the SMILES notation for CID 67744979?
The canonical SMILES for CID 67744979 is Oc1ccccc1/C=C/O[Si].
What is the InChIKey of CID 67744979?
The InChIKey is OUMLSXISVALKIH-AATRIKPKSA-N. The full InChI is InChI=1S/C8H7O2Si/c9-8-4-2-1-3-7(8)5-6-10-11/h1-6,9H/b6-5+.
What are the key properties of CID 67744979?
CID 67744979 has a molecular weight of 163.23 g/mol, XLogP of 1.46, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 67744979 is sourced from PubChem (CID 67744979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).