C20H40Cl2N6O4 — CID 67746062
ethyl 3-[[(2S)-2-amino-4-[[(3S)-1-carbamimidoylpiperidin-3-yl]-methylamino]-4-oxobutanoyl]-butylamino]propanoate;dihydrochloride (PubChem CID 67746062) has the molecular formula C20H40Cl2N6O4 and a molecular weight of 499.48 g/mol. Its IUPAC name is ethyl 3-[[(2S)-2-amino-4-[[(3S)-1-carbamimidoylpiperidin-3-yl]-methylamino]-4-oxobutanoyl]-butylamino]propanoate;dihydrochloride.
| Compound Name | ethyl 3-[[(2S)-2-amino-4-[[(3S)-1-carbamimidoylpiperidin-3-yl]-methylamino]-4-oxobutanoyl]-butylamino]propanoate;dihydrochloride |
|---|---|
| PubChem CID | 67746062 |
| Molecular Formula | C20H40Cl2N6O4 |
| Molecular Weight | 499.48 g/mol |
| Exact Mass | 498.25 |
| IUPAC Name | ethyl 3-[[(2S)-2-amino-4-[[(3S)-1-carbamimidoylpiperidin-3-yl]-methylamino]-4-oxobutanoyl]-butylamino]propanoate;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\N)N1CCC[C@H](N(C)C(=O)C[C@H](N)C(=O)N(CCCC)CCC(=O)OCC)C1 |
| InChI | InChI=1S/C20H38N6O4.2ClH/c1-4-6-10-25(12-9-18(28)30-5-2)19(29)16(21)13-17(27)24(3)15-8-7-11-26(14-15)20(22)23;;/h15-16H,4-14,21H2,1-3H3,(H3,22,23);2*1H/t15-,16-;;/m0../s1 |
| InChIKey | GSCKFDPFMVPXJI-SXBSVMRRSA-N |
| XLogP | 0.95 |
| TPSA | 146.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.48 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|