C19H34N6O4 — CID 67746339
ethyl 3-[[(2S)-2-amino-4-[[(3S)-1-carbamimidoylpiperidin-3-yl]-methylamino]-4-oxobutanoyl]-cyclopropylamino]propanoate (PubChem CID 67746339) has the molecular formula C19H34N6O4 and a molecular weight of 410.52 g/mol. Its IUPAC name is ethyl 3-[[(2S)-2-amino-4-[[(3S)-1-carbamimidoylpiperidin-3-yl]-methylamino]-4-oxobutanoyl]-cyclopropylamino]propanoate.
| Compound Name | ethyl 3-[[(2S)-2-amino-4-[[(3S)-1-carbamimidoylpiperidin-3-yl]-methylamino]-4-oxobutanoyl]-cyclopropylamino]propanoate |
|---|---|
| PubChem CID | 67746339 |
| Molecular Formula | C19H34N6O4 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.26 |
| IUPAC Name | ethyl 3-[[(2S)-2-amino-4-[[(3S)-1-carbamimidoylpiperidin-3-yl]-methylamino]-4-oxobutanoyl]-cyclopropylamino]propanoate |
| SMILES | [H]/N=C(\N)N1CCC[C@H](N(C)C(=O)C[C@H](N)C(=O)N(CCC(=O)OCC)C2CC2)C1 |
| InChI | InChI=1S/C19H34N6O4/c1-3-29-17(27)8-10-25(13-6-7-13)18(28)15(20)11-16(26)23(2)14-5-4-9-24(12-14)19(21)22/h13-15H,3-12,20H2,1-2H3,(H3,21,22)/t14-,15-/m0/s1 |
| InChIKey | MJUJEBFQDZQZBB-GJZGRUSLSA-N |
| XLogP | -0.54 |
| TPSA | 146.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|