C22H29NO2 — CID 67747023
2-[(8R,9S,14S,17S)-13-ethyl-17-hydroxy-3-methoxy-2,6,7,8,9,11,12,14-octahydro-1H-cyclopenta[a]phenanthren-17-yl]acetonitrile (PubChem CID 67747023) has the molecular formula C22H29NO2 and a molecular weight of 339.48 g/mol. Its IUPAC name is 2-[(8R,9S,14S,17S)-13-ethyl-17-hydroxy-3-methoxy-2,6,7,8,9,11,12,14-octahydro-1H-cyclopenta[a]phenanthren-17-yl]acetonitrile.
| Compound Name | 2-[(8R,9S,14S,17S)-13-ethyl-17-hydroxy-3-methoxy-2,6,7,8,9,11,12,14-octahydro-1H-cyclopenta[a]phenanthren-17-yl]acetonitrile |
|---|---|
| PubChem CID | 67747023 |
| Molecular Formula | C22H29NO2 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | 2-[(8R,9S,14S,17S)-13-ethyl-17-hydroxy-3-methoxy-2,6,7,8,9,11,12,14-octahydro-1H-cyclopenta[a]phenanthren-17-yl]acetonitrile |
| SMILES | CCC12CC[C@@H]3C4=C(C=C(OC)CC4)CC[C@H]3[C@@H]1C=C[C@@]2(O)CC#N |
| InChI | InChI=1S/C22H29NO2/c1-3-21-10-8-18-17-7-5-16(25-2)14-15(17)4-6-19(18)20(21)9-11-22(21,24)12-13-23/h9,11,14,18-20,24H,3-8,10,12H2,1-2H3/t18-,19-,20+,21?,22-/m1/s1 |
| InChIKey | KUGIDTBNXSEQST-ZHXVYXOISA-N |
| XLogP | 4.65 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|