C25H47N — CID 67749560
2,6-dimethyl-2,3,5-tripentyl-1-prop-2-enyl-3,4-dihydropyridine (PubChem CID 67749560) has the molecular formula C25H47N and a molecular weight of 361.66 g/mol. Its IUPAC name is 2,6-dimethyl-2,3,5-tripentyl-1-prop-2-enyl-3,4-dihydropyridine.
| Compound Name | 2,6-dimethyl-2,3,5-tripentyl-1-prop-2-enyl-3,4-dihydropyridine |
|---|---|
| PubChem CID | 67749560 |
| Molecular Formula | C25H47N |
| Molecular Weight | 361.66 g/mol |
| Exact Mass | 361.37 |
| IUPAC Name | 2,6-dimethyl-2,3,5-tripentyl-1-prop-2-enyl-3,4-dihydropyridine |
| SMILES | C=CCN1C(C)=C(CCCCC)CC(CCCCC)C1(C)CCCCC |
| InChI | InChI=1S/C25H47N/c1-7-11-14-17-23-21-24(18-15-12-8-2)25(6,19-16-13-9-3)26(20-10-4)22(23)5/h10,24H,4,7-9,11-21H2,1-3,5-6H3 |
| InChIKey | JUYZZTPRLQGNCO-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.66 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|